CAS 727736-63-2 appears in our catalog under these names: Methyl 6–cyano–5–hydroxypicolinate, Methyl 6-cyano-5-hydroxypicolinate 90%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 6-cyano-5-hydroxypyridine-2-carboxylate (CAS 727736-63-2) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: methyl 6-cyano-5-hydroxypyridine-2-carboxylate. InChIKey: IWTIJXBNWUKZRK-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | methyl 6-cyano-5-hydroxypyridine-2-carboxylate |
| InChIKey | IWTIJXBNWUKZRK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C=C1)O)C#N |
Computed by PubChem (NCBI)