CAS 728024-58-6 appears in our catalog under these names: 4-(1H-Tetrazol-1-ylmethyl)benzoic Acid, 4-((1h-Tetrazol-1-yl)methyl)benzoic acid, 97%, 97%, 4-Tetrazol-1-ylmethyl-benzoic acid, 98%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
4-(tetrazol-1-ylmethyl)benzoic acid (CAS 728024-58-6) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 4-(tetrazol-1-ylmethyl)benzoic acid. InChIKey: CYMQAEKQHNYLMH-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 4-(tetrazol-1-ylmethyl)benzoic acid |
| InChIKey | CYMQAEKQHNYLMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NN=N2)C(=O)O |
Computed by PubChem (NCBI)