Products 730234-73-8
CAS 730234-73-8 appears in our catalog under these names: 2-(4-Amino-phenyl)-thiazole-4-carboxylic acid ethyl ester, ≥95%, Ethyl 2-(4-aminophenyl)thiazole-4-carboxylate, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 2-(4-aminophenyl)-1,3-thiazole-4-carboxylate (CAS 730234-73-8) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: ethyl 2-(4-aminophenyl)-1,3-thiazole-4-carboxylate. InChIKey: LZHUXAJBTASELP-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | ethyl 2-(4-aminophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | LZHUXAJBTASELP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)