CAS 730247-51-5 appears in our catalog under these names: (4-Bromophenyl)methyl 2-hydroxybenzoate, 95%, (4-Bromophenyl)methyl 2-hydroxybenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
(4-bromophenyl)methyl 2-hydroxybenzoate (CAS 730247-51-5) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: (4-bromophenyl)methyl 2-hydroxybenzoate. InChIKey: CFRXPMSUVFUNGV-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | (4-bromophenyl)methyl 2-hydroxybenzoate |
| InChIKey | CFRXPMSUVFUNGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)OCC2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)