CAS 73031-16-0 is the registry number for 2-(1H-Indol-3-yl)-2-oxo-N-phenylacetamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 100mg, 250mg, 1g.
2-(1H-indol-3-yl)-2-oxo-N-phenylacetamide (CAS 73031-16-0) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 2-(1H-indol-3-yl)-2-oxo-N-phenylacetamide. InChIKey: WMCHMBHWRLPJKP-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-2-oxo-N-phenylacetamide |
| InChIKey | WMCHMBHWRLPJKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C(=O)C2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)