Products 7312-27-8
CAS 7312-27-8 appears in our catalog under these names: (E)-3-(3,4-Dichlorophenyl)acrylic acid 95+%, (E)-3-(3,4-Dichlorophenyl)acrylic Acid, 95+%, 95+%, (E)-3-(3,4-Dichlorophenyl)acrylic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
(E)-3-(3,4-dichlorophenyl)prop-2-enoic acid (CAS 7312-27-8) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: (E)-3-(3,4-dichlorophenyl)prop-2-enoic acid. InChIKey: RRLUFPHCTSFKNR-DUXPYHPUSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | (E)-3-(3,4-dichlorophenyl)prop-2-enoic acid |
| InChIKey | RRLUFPHCTSFKNR-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Propenoic acid, 3-(3,4-dichlorophenyl)-, Cinnamic acid, 3,4-dichloro-, 3',4'-Dichlorocinnamic acid, (2E)-3-(3,4-dichlorophenyl)prop-2-enoic acid, 3-(3,4-Dichlorophenyl)-2-propenoic acid, Cinnamic acid, 3,4-dichloro-(8CI), (E)-3-(3,4-Dichlorophenyl)acrylic acid, 3-(3,4-Dichlorophenyl)acrylic acid, (E)-3-(3,4-dichlorophenyl)prop-2-enoic acid, (E)-3,4-dichlorocinnamic acid