Products 731827-21-7
CAS 731827-21-7 is the registry number for 7-Chloro-3-(2-methylpropyl)-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
7-chloro-3-(2-methylpropyl)-2-sulfanylidene-1H-quinazolin-4-one (CAS 731827-21-7) is a chemical compound with the molecular formula C12H13ClN2OS and a molecular weight of 268.76 g/mol. IUPAC name: 7-chloro-3-(2-methylpropyl)-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: RLQNVKNSLIDVRH-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2OS |
|---|---|
| Molecular weight | 268.76 g/mol |
| IUPAC name | 7-chloro-3-(2-methylpropyl)-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | RLQNVKNSLIDVRH-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C(=O)C2=C(C=C(C=C2)Cl)NC1=S |
Computed by PubChem (NCBI)