CAS 732242-02-3 is the registry number for (S)-3-Amino-3-(2-nitro-phenyl)-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3S)-3-amino-3-(2-nitrophenyl)propanoic acid (CAS 732242-02-3) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: (3S)-3-amino-3-(2-nitrophenyl)propanoic acid. InChIKey: XXBOYULKNZTOMN-ZETCQYMHSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | (3S)-3-amino-3-(2-nitrophenyl)propanoic acid |
| InChIKey | XXBOYULKNZTOMN-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CC(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)