Products 732294-40-5

CAS 732294-40-5 is the registry number for Naphtho[2,1-b]furan-1-acetic acid, 2-oxo-2-[(1-phenylethyl)amino]ethyl ester, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

[2-oxo-2-(1-phenylethylamino)ethyl] 2-benzo[e][1]benzofuran-1-ylacetate (CAS 732294-40-5) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: [2-oxo-2-(1-phenylethylamino)ethyl] 2-benzo[e][1]benzofuran-1-ylacetate. InChIKey: WKXVPBNNNWFVTF-UHFFFAOYSA-N.

Identity
Molecular formulaC24H21NO4
Molecular weight387.4 g/mol
IUPAC name[2-oxo-2-(1-phenylethylamino)ethyl] 2-benzo[e][1]benzofuran-1-ylacetate
InChIKeyWKXVPBNNNWFVTF-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1)NC(=O)COC(=O)CC2=COC3=C2C4=CC=CC=C4C=C3

Computed by PubChem (NCBI)