Products 735-16-0
CAS 735-16-0 is the registry number for GLUT-1-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[2-(5-nitrofuran-2-yl)ethenyl]quinoline (CAS 735-16-0) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 4-[2-(5-nitrofuran-2-yl)ethenyl]quinoline. InChIKey: PJOXAWCIGXMTTB-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 4-[2-(5-nitrofuran-2-yl)ethenyl]quinoline |
| InChIKey | PJOXAWCIGXMTTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)C=CC3=CC=C(O3)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
orb2945523, 4-[2-(5-nitro-2-furyl)vinyl]quinoline