Products 73799-63-0
CAS 73799-63-0 appears in our catalog under these names: 3-Benzyl-3-azabicyclo[3.1.0]hexane-2,4-dione, 95%, 3–Benzyl–3–azabicyclo(3·1·0)hexane–2,4–dione, 3-Benzyl-3-azabicyclo[3.1.0]hexane-2,4-dione, >98.0%(GC)(N), 3-Benzyl-3-azabicyclo[3.1.0]hexane-2,4-dione, 97%, 97%, 3-Benzyl-3-azabicyclo[3.1.0]hexane-2,4-dione, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 200mg, 100mg.
3-benzyl-3-azabicyclo[3.1.0]hexane-2,4-dione (CAS 73799-63-0) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 3-benzyl-3-azabicyclo[3.1.0]hexane-2,4-dione. InChIKey: JEISWFNRNZRSHM-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 3-benzyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| InChIKey | JEISWFNRNZRSHM-UHFFFAOYSA-N |
| SMILES | C1C2C1C(=O)N(C2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)