CAS 7384-17-0 appears in our catalog under these names: 3-Oxo-4-indazoline carboxylic acid, 95%, 2,3-DIhydro-3-oxo-1H-indazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg.
3-oxo-1,2-dihydroindazole-4-carboxylic acid (CAS 7384-17-0) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 3-oxo-1,2-dihydroindazole-4-carboxylic acid. InChIKey: BUCGZRNYKPSWMC-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 3-oxo-1,2-dihydroindazole-4-carboxylic acid |
| InChIKey | BUCGZRNYKPSWMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NNC2=O)C(=O)O |
Computed by PubChem (NCBI)