CAS 73853-05-1 appears in our catalog under these names: 3,5,6-Trihydroxy-1-isopropylindole, Noradrenaline (Norepinephrine) Impurity 81, Isoproterenol Impurity 14. Offered by: TRC, Chemat Brand. Available pack sizes: 2,5mg, 25mg, on request.
1-propan-2-ylindole-3,5,6-triol (CAS 73853-05-1) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 1-propan-2-ylindole-3,5,6-triol. InChIKey: OGRIJODCJMPIOE-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 1-propan-2-ylindole-3,5,6-triol |
| InChIKey | OGRIJODCJMPIOE-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C2=CC(=C(C=C21)O)O)O |
Computed by PubChem (NCBI)