CAS 74126-25-3 is the registry number for (R)-Ethyl 2-amino-3-(1H-indol-3-yl)propanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate (CAS 74126-25-3) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate. InChIKey: DABYEOZXRSTEGL-LLVKDONJSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | ethyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate |
| InChIKey | DABYEOZXRSTEGL-LLVKDONJSA-N |
| SMILES | CCOC(=O)[C@@H](CC1=CNC2=CC=CC=C21)N |
Computed by PubChem (NCBI)