Products 7479-05-2

CAS 7479-05-2 is the registry number for Tadalafil Impurity 86. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Ethyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate (CAS 7479-05-2) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: ethyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate. InChIKey: DABYEOZXRSTEGL-NSHDSACASA-N.

Identity
Molecular formulaC13H16N2O2
Molecular weight232.28 g/mol
IUPAC nameethyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate
InChIKeyDABYEOZXRSTEGL-NSHDSACASA-N
SMILESCCOC(=O)[C@H](CC1=CNC2=CC=CC=C21)N

Computed by PubChem (NCBI)