CAS 743440-50-8 is the registry number for 6-(2-Chlorophenyl)-1,3-diazinane-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(2-chlorophenyl)-1,3-diazinane-2,4-dione (CAS 743440-50-8) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 6-(2-chlorophenyl)-1,3-diazinane-2,4-dione. InChIKey: WUIXYAGXETURNF-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 6-(2-chlorophenyl)-1,3-diazinane-2,4-dione |
| InChIKey | WUIXYAGXETURNF-UHFFFAOYSA-N |
| SMILES | C1C(NC(=O)NC1=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)