CAS 74345-23-6 is the registry number for 3-(4-hydroxybenzyl)hexahydropyrrolo(1,2-a)pyrazine-1,4-dione. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclo(Tyr-Pro) is an organonitrogen compound and an organooxygen compound. It is functionally related to an alpha-amino acid.
Source: ChEBI
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 3-[(4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | LSGOTAXPWMCUCK-UHFFFAOYSA-N |
| SMILES | C1CC2C(=O)NC(C(=O)N2C1)CC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)