CAS 743466-98-0 appears in our catalog under these names: 6-Bromo-2-fluoro-3-methylbenzoic acid, 98%, 98%, 6-Bromo-2-fluoro-3-methylbenzoic acid, 6-BROMO-2-FLUORO-3-METHYLBENZOIC ACID, 98%. Offered by: Chemat, Biosynth, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
6-bromo-2-fluoro-3-methylbenzoic acid (CAS 743466-98-0) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 6-bromo-2-fluoro-3-methylbenzoic acid. InChIKey: QNGVPYFPKLUQDX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-methylbenzoic acid |
| InChIKey | QNGVPYFPKLUQDX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Br)C(=O)O)F |
Computed by PubChem (NCBI)