CAS 7437-54-9 appears in our catalog under these names: 4-Hydroxy Ephedrine HCl , 4–hydroxyephedrine hydrochloride. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 20mg.
4-[1-hydroxy-2-(methylamino)propyl]phenol;hydrochloride (CAS 7437-54-9) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 4-[1-hydroxy-2-(methylamino)propyl]phenol;hydrochloride. InChIKey: ICBZSKCTKKUQSY-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 4-[1-hydroxy-2-(methylamino)propyl]phenol;hydrochloride |
| InChIKey | ICBZSKCTKKUQSY-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC=C(C=C1)O)O)NC.Cl |
Computed by PubChem (NCBI)