Products 744-80-9
CAS 744-80-9 appears in our catalog under these names: 1-Benzoyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione, 98%+,RG, 98%+,RG, Benzobarbital, BENZOBARBITAL, 98%+,RG. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 5g, Get quote.
1-benzoyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione (CAS 744-80-9) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: 1-benzoyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione. InChIKey: QMOWPJIFTHVQMB-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 1-benzoyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| InChIKey | QMOWPJIFTHVQMB-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)NC(=O)N(C1=O)C(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)