CAS 74469-70-8 is the registry number for 6-Hydroxy-2,2-dimethyl-2H-benzo(e)(1,3)oxazin-4(3H)-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-hydroxy-2,2-dimethyl-3H-1,3-benzoxazin-4-one (CAS 74469-70-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 6-hydroxy-2,2-dimethyl-3H-1,3-benzoxazin-4-one. InChIKey: VNTPFMOUPGCKFE-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 6-hydroxy-2,2-dimethyl-3H-1,3-benzoxazin-4-one |
| InChIKey | VNTPFMOUPGCKFE-UHFFFAOYSA-N |
| SMILES | CC1(NC(=O)C2=C(O1)C=CC(=C2)O)C |
Computed by PubChem (NCBI)