CAS 74590-68-4 appears in our catalog under these names: 2-(3-Chlorophenyl)-2-fluoroacetic acid, 95%, 2-(3-Chlorophenyl)-2-fluoroacetic acid, 2-(3-Chlorophenyl)-2-fluoroacetic Acid, 97%, 97%, 2-(3-Chlorophenyl)-2-fluoroacetic acid, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 0,5g, 100mg, 250mg.
2-(3-chlorophenyl)-2-fluoroacetic acid (CAS 74590-68-4) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-(3-chlorophenyl)-2-fluoroacetic acid. InChIKey: FPMGQESXBDVAGY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-2-fluoroacetic acid |
| InChIKey | FPMGQESXBDVAGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C(=O)O)F |
Computed by PubChem (NCBI)