CAS 74709-95-8 is the registry number for Lidocaine Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dimethyl-2,5-dinitrobenzene (CAS 74709-95-8) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 1,3-dimethyl-2,5-dinitrobenzene. InChIKey: SDNAHHNWZYDYHA-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 1,3-dimethyl-2,5-dinitrobenzene |
| InChIKey | SDNAHHNWZYDYHA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1[N+](=O)[O-])C)[N+](=O)[O-] |
Computed by PubChem (NCBI)