Products 74815-17-1
CAS 74815-17-1 appears in our catalog under these names: (2E)-3-(3-formylphenyl)prop-2-enoic acid, 97%, 97%, (E)-3-(3-Formylphenyl)acrylic acid, 97%, (2E)-3-(3-FORMYLPHENYL)PROP-2-ENOIC ACID, 97%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
(E)-3-(3-formylphenyl)prop-2-enoic acid (CAS 74815-17-1) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (E)-3-(3-formylphenyl)prop-2-enoic acid. InChIKey: PQXAPANLBKXEKT-SNAWJCMRSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (E)-3-(3-formylphenyl)prop-2-enoic acid |
| InChIKey | PQXAPANLBKXEKT-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)C=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(E)-3-(3-Formylphenyl)acrylic acid, (2E)-3-(3-formylphenyl)prop-2-enoic acid, 3-Formylcinnamic acid, 3-(3-Formylphenyl)acrylic acid, (E)-3-(3-formylphenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(3-formylphenyl)-, (E)-, 2-Propenoic acid, 3-(3-formylphenyl)-, (2E)-, (E)-3-(3-Formylphenyl)acrylic acid - [F90421]