CAS 749931-20-2 appears in our catalog under these names: 4-Bromo-2-fluoro-5-methoxybenzaldehyde 98%, 4-BROMO-2-FLUORO-5-METHOXYBENZALDEHYDE, 97%, 4-Bromo-2-Fluoro-5-Methoxybenzaldehyde, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g, 2g, 10g.
4-bromo-2-fluoro-5-methoxybenzaldehyde (CAS 749931-20-2) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 4-bromo-2-fluoro-5-methoxybenzaldehyde. InChIKey: TWHBNRXZMJJLJO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-methoxybenzaldehyde |
| InChIKey | TWHBNRXZMJJLJO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)F)Br |
Computed by PubChem (NCBI)