Products 750633-59-1

CAS 750633-59-1 is the registry number for 3-Cyano-3'-methoxybenzophenone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

3-(3-methoxybenzoyl)benzonitrile (CAS 750633-59-1) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 3-(3-methoxybenzoyl)benzonitrile. InChIKey: JANXXVJXZIIACM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11NO2
Molecular weight237.25 g/mol
IUPAC name3-(3-methoxybenzoyl)benzonitrile
InChIKeyJANXXVJXZIIACM-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1)C(=O)C2=CC=CC(=C2)C#N

Computed by PubChem (NCBI)