Products 75187-42-7
CAS 75187-42-7 is the registry number for 1-Propanone, 1-(3-chloro-4-methylphenyl)-2-methyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-(3-chloro-4-methylphenyl)-2-methylpropan-1-one (CAS 75187-42-7) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 1-(3-chloro-4-methylphenyl)-2-methylpropan-1-one. InChIKey: SZFUMJFOSSXMAY-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 1-(3-chloro-4-methylphenyl)-2-methylpropan-1-one |
| InChIKey | SZFUMJFOSSXMAY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(C)C)Cl |
Computed by PubChem (NCBI)