CAS 75200-79-2 is the registry number for 2,2-Dimethyl-1,3-benzodioxol-5-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
2,2-dimethyl-1,3-benzodioxol-5-amine;hydrochloride (CAS 75200-79-2) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 2,2-dimethyl-1,3-benzodioxol-5-amine;hydrochloride. InChIKey: BAJJTAFSZXKUPV-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 2,2-dimethyl-1,3-benzodioxol-5-amine;hydrochloride |
| InChIKey | BAJJTAFSZXKUPV-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(O1)C=C(C=C2)N)C.Cl |
Computed by PubChem (NCBI)