Products 75381-46-3
CAS 75381-46-3 appears in our catalog under these names: 5–(3–Chlorophenyl)–5–oxovaleric acid, 5-(3-Chlorophenyl)-5-oxovaleric acid, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
5-(3-chlorophenyl)-5-oxopentanoic acid (CAS 75381-46-3) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: 5-(3-chlorophenyl)-5-oxopentanoic acid. InChIKey: HFTNETNQJWKQFK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-5-oxopentanoic acid |
| InChIKey | HFTNETNQJWKQFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)CCCC(=O)O |
Computed by PubChem (NCBI)