CAS 299165-24-5 appears in our catalog under these names: 3-Amino-3-(2-(trifluoromethyl)phenyl)propanoic acid, 95%, 95%, 3-Amino-3-(2-(trifluoromethyl)phenyl)propanoic acid, 95%, 3-Amino-3-[2-(trifluoromethyl)phenyl]propionic Acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 299165-24-5) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: 3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: MXKROQQTKYAUJB-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | MXKROQQTKYAUJB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CC(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)