Products 757176-96-8
CAS 757176-96-8 is the registry number for Dinoxyline. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-oxa-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-5,6-diol (CAS 757176-96-8) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 8-oxa-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-5,6-diol. InChIKey: QOHSTVKJXZTEOL-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 8-oxa-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9,11,13(17)-hexaene-5,6-diol |
| InChIKey | QOHSTVKJXZTEOL-UHFFFAOYSA-N |
| SMILES | C1C2C3=C(C(=C(C=C3)O)O)OC4=CC=CC(=C24)CN1 |
Computed by PubChem (NCBI)