CAS 75748-36-6 appears in our catalog under these names: H–D–Thr–OBzl·HCl, D-Threonine Benzyl Ester Hydrochloride, >98.0%(HPLC)(N), Cbz-D-Thr-OBzl HCl 97%, D-Threonine benzyl ester, HCl, 97%, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
Benzyl (2R,3S)-2-amino-3-hydroxybutanoate;hydrochloride (CAS 75748-36-6) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: benzyl (2R,3S)-2-amino-3-hydroxybutanoate;hydrochloride. InChIKey: IDZGTFSDZJVMSD-KXNXZCPBSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | benzyl (2R,3S)-2-amino-3-hydroxybutanoate;hydrochloride |
| InChIKey | IDZGTFSDZJVMSD-KXNXZCPBSA-N |
| SMILES | C[C@@H]([C@H](C(=O)OCC1=CC=CC=C1)N)O.Cl |
Computed by PubChem (NCBI)