CAS 780758-27-2 appears in our catalog under these names: Benzyl (2S,3S)-2-amino-3-hydroxybutanoate hydrochloride, Benzyl (2S,3S)-2-amino-3-hydroxybutanoate hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
Benzyl (2S,3S)-2-amino-3-hydroxybutanoate;hydrochloride (CAS 780758-27-2) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: benzyl (2S,3S)-2-amino-3-hydroxybutanoate;hydrochloride. InChIKey: IDZGTFSDZJVMSD-GNAZCLTHSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | benzyl (2S,3S)-2-amino-3-hydroxybutanoate;hydrochloride |
| InChIKey | IDZGTFSDZJVMSD-GNAZCLTHSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)OCC1=CC=CC=C1)N)O.Cl |
Computed by PubChem (NCBI)