CAS 75786-75-3 is the registry number for 4,6,7-Trimethyl-2H-chromen-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6,7-trimethylchromen-2-one (CAS 75786-75-3) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 4,6,7-trimethylchromen-2-one. InChIKey: RYGXMOYSSBNDQZ-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 4,6,7-trimethylchromen-2-one |
| InChIKey | RYGXMOYSSBNDQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)OC(=O)C=C2C |
Computed by PubChem (NCBI)