CAS 76315-33-8 appears in our catalog under these names: Ethyl 2-amino-3,5-dichlorobenzoate, 98%, Ethyl 2-amino-3,5-dichlorobenzoate, 97%, 97%, Ethyl 2-amino-3,5-dichlorobenzoate, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g, 100g.
Ethyl 2-amino-3,5-dichlorobenzoate (CAS 76315-33-8) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: ethyl 2-amino-3,5-dichlorobenzoate. InChIKey: VPLRCCUPLQJQDP-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | ethyl 2-amino-3,5-dichlorobenzoate |
| InChIKey | VPLRCCUPLQJQDP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC(=C1)Cl)Cl)N |
Computed by PubChem (NCBI)