Products 76400-25-4
CAS 76400-25-4 appears in our catalog under these names: L-Alanyl-(4R)-4-hydroxy-L-proline, 95%, H-Ala-Hyp-OH, 99.36%. Offered by: Chemat, MedChemExpress. Available pack sizes: 50mg, 100mg, 25 mg, 10mM/1mL, 100 mg, 10 mg, 5 mg, 50 mg.
(2S,4R)-1-[(2S)-2-aminopropanoyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS 76400-25-4) is a chemical compound with the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. IUPAC name: (2S,4R)-1-[(2S)-2-aminopropanoyl]-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: KYHSUPXEBSYFGK-JKUQZMGJSA-N.
| Molecular formula | C8H14N2O4 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | (2S,4R)-1-[(2S)-2-aminopropanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | KYHSUPXEBSYFGK-JKUQZMGJSA-N |
| SMILES | C[C@@H](C(=O)N1C[C@@H](C[C@H]1C(=O)O)O)N |
Computed by PubChem (NCBI)