Products 76478-47-2
CAS 76478-47-2 appears in our catalog under these names: 4-Hydroxybenzophenone-d5, 4-Hydroxybenzophenone-d5, 98.93%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 10 mg, 1 mg, 5 mg.
(4-hydroxyphenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone (CAS 76478-47-2) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 203.25 g/mol. IUPAC name: (4-hydroxyphenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone. InChIKey: NPFYZDNDJHZQKY-RALIUCGRSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 203.25 g/mol |
| IUPAC name | (4-hydroxyphenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone |
| InChIKey | NPFYZDNDJHZQKY-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=CC=C(C=C2)O)[2H])[2H] |
Computed by PubChem (NCBI)