CAS 93496-64-1 appears in our catalog under these names: 4–Hydroxybenzophenone–d4, 4-Hydroxybenzophenone-d4, 4-Hydroxybenzophenone-d4, >95% (HPLC). Offered by: GLPBio, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 1mg, on request, 10mg, 2,5mg, 1 mg.
Phenyl-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)methanone (CAS 93496-64-1) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 202.24 g/mol. IUPAC name: phenyl-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)methanone. InChIKey: NPFYZDNDJHZQKY-YKVCKAMESA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 202.24 g/mol |
| IUPAC name | phenyl-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)methanone |
| InChIKey | NPFYZDNDJHZQKY-YKVCKAMESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)C2=CC=CC=C2)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)