CAS 76537-42-3 appears in our catalog under these names: 5,6–Dichloropyrazine–2–carboxylic acid, 5,6-Dichloropyrazine-2-carboxylic acid, 95%, 95%, 5,6-Dichloropyrazine-2-carboxylic acid, 97%, 5,6-Dichloropyrazine-2-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 500mg, 5g.
5,6-dichloropyrazine-2-carboxylic acid (CAS 76537-42-3) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 5,6-dichloropyrazine-2-carboxylic acid. InChIKey: VVZNBAQAYLMLGO-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 5,6-dichloropyrazine-2-carboxylic acid |
| InChIKey | VVZNBAQAYLMLGO-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)