Products 76604-64-3
CAS 76604-64-3 is the registry number for M-5011. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-[4-(3-methylthiophen-2-yl)phenyl]propanoic acid (CAS 76604-64-3) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: (2R)-2-[4-(3-methylthiophen-2-yl)phenyl]propanoic acid. InChIKey: DTOPKPBTCXKNFF-SNVBAGLBSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | (2R)-2-[4-(3-methylthiophen-2-yl)phenyl]propanoic acid |
| InChIKey | DTOPKPBTCXKNFF-SNVBAGLBSA-N |
| SMILES | CC1=C(SC=C1)C2=CC=C(C=C2)[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzeneacetic acid, alpha-methyl-4-(3-methyl-2-thienyl)-, (R)-, 2-(4-(3-Methyl-2-thienyl)phenyl)propionic acid, (2r)-2-[4-(3-methylthiophen-2-yl)phenyl]propanoic acid, orb1700015, (R)-2-(4-(3-methylthiophen-2-yl)phenyl)propanoic acid, (R)-alpha-Methyl-4-(3-methyl-2-thienyl)benzeneacetic acid