Products 77095-51-3
CAS 77095-51-3 appears in our catalog under these names: Lifitegrast Impurity 29, Lifitegrast Impurity 11, Benzofuran-6-carboxylic Acid, >95% (HPLC), 1-Benzofuran-6-carboxylic acid, Benzofuran-6-carboxylic acid 98%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 1g, 250mg, 10g, 25g, 50g, 100g, 100mg.
1-benzofuran-6-carboxylic acid (CAS 77095-51-3) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 1-benzofuran-6-carboxylic acid. InChIKey: RVDHGRQELZPGCO-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 1-benzofuran-6-carboxylic acid |
| InChIKey | RVDHGRQELZPGCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CO2)C(=O)O |
Computed by PubChem (NCBI)