Products 77342-17-7

CAS 77342-17-7 is the registry number for Bis(o-cresyl) m-Cresyl Phosphate. Offered by: TRC. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

Bis(2-methylphenyl) (3-methylphenyl) phosphate (CAS 77342-17-7) is a chemical compound with the molecular formula C21H21O4P and a molecular weight of 368.4 g/mol. IUPAC name: bis(2-methylphenyl) (3-methylphenyl) phosphate. InChIKey: VVKLDZBAUZBOTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC21H21O4P
Molecular weight368.4 g/mol
IUPAC namebis(2-methylphenyl) (3-methylphenyl) phosphate
InChIKeyVVKLDZBAUZBOTJ-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)OP(=O)(OC2=CC=CC=C2C)OC3=CC=CC=C3C

Computed by PubChem (NCBI)