Products 77359-11-6
CAS 77359-11-6 appears in our catalog under these names: Mono–4–nitrobenzyl Malonate, Mono-4-nitrobenzyl Malonate, >98.0%(T)(HPLC), 3-((4-Nitrobenzyl)oxy)-3-oxopropanoic acid, 97%, 97%, 3-((4-Nitrobenzyl)oxy)-3-oxopropanoic acid, 97%, 3-((4-Nitrobenzyl)oxy)-3-oxopropanoic acid 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 5g, 25g, 10g, 500g, 1kg, 1000g.
3-[(4-nitrophenyl)methoxy]-3-oxopropanoic acid (CAS 77359-11-6) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: 3-[(4-nitrophenyl)methoxy]-3-oxopropanoic acid. InChIKey: RIGFMUNSTCPGNP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | 3-[(4-nitrophenyl)methoxy]-3-oxopropanoic acid |
| InChIKey | RIGFMUNSTCPGNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC(=O)CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Mono-4-nitrobenzyl Malonate, 3-((4-Nitrobenzyl)oxy)-3-oxopropanoic acid, 4-Nitrobenzyl hydrogen malonate, 3-[(4-nitrophenyl)methoxy]-3-oxopropanoic acid, 2-{[(4-nitrophenyl)methyl]oxycarbonyl}acetic Acid, Malonic Acid Mono-4-nitrobenzyl Ester, 3-[(4-Nitrobenzyl)oxy]-3-oxopropanoic acid, mono-p-nitrobenzyl malonate, Propanedioic acid, mono[(4-nitrophenyl)methyl] ester, p-nitrobenzyl malonate