CAS 77366-71-3 is the registry number for 6-Methoxy-3-oxo-2,3-dihydro-1H-indene-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methoxy-3-oxo-1,2-dihydroindene-5-carboxylic acid (CAS 77366-71-3) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 6-methoxy-3-oxo-1,2-dihydroindene-5-carboxylic acid. InChIKey: CSECSQHRXAOUKM-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 6-methoxy-3-oxo-1,2-dihydroindene-5-carboxylic acid |
| InChIKey | CSECSQHRXAOUKM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC2=O)C(=O)O |
Computed by PubChem (NCBI)