Products 773850-90-1
CAS 773850-90-1 is the registry number for Drimiopsin C. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3,6-trihydroxy-2-methoxy-8-methylxanthen-9-one (CAS 773850-90-1) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: 1,3,6-trihydroxy-2-methoxy-8-methylxanthen-9-one. InChIKey: IMMSZLMLFUYPBT-UHFFFAOYSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 1,3,6-trihydroxy-2-methoxy-8-methylxanthen-9-one |
| InChIKey | IMMSZLMLFUYPBT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C(=O)C3=C(O2)C=C(C(=C3O)OC)O)O |
Computed by PubChem (NCBI)