Products 77402-03-0

CAS 77402-03-0 is the registry number for Methyl Acrylamidoglycolate Methyl Ester. Offered by: TRC, Biosynth. Available pack sizes: 5g, 50mg, 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Methyl 2-methoxy-2-(prop-2-enoylamino)acetate (CAS 77402-03-0) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: methyl 2-methoxy-2-(prop-2-enoylamino)acetate. InChIKey: JMSTYCQEPRPFBF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO4
Molecular weight173.17 g/mol
IUPAC namemethyl 2-methoxy-2-(prop-2-enoylamino)acetate
InChIKeyJMSTYCQEPRPFBF-UHFFFAOYSA-N
SMILESCOC(C(=O)OC)NC(=O)C=C

Computed by PubChem (NCBI)