CAS 77430-27-4 is the registry number for Salbutamol Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
[2-acetyloxy-5-[2-[benzyl(tert-butyl)amino]acetyl]phenyl]methyl acetate (CAS 77430-27-4) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: [2-acetyloxy-5-[2-[benzyl(tert-butyl)amino]acetyl]phenyl]methyl acetate. InChIKey: NCQOUEUIEVCLCE-UHFFFAOYSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | [2-acetyloxy-5-[2-[benzyl(tert-butyl)amino]acetyl]phenyl]methyl acetate |
| InChIKey | NCQOUEUIEVCLCE-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=CC(=C1)C(=O)CN(CC2=CC=CC=C2)C(C)(C)C)OC(=O)C |
Computed by PubChem (NCBI)