Products 77430-27-4

CAS 77430-27-4 is the registry number for Salbutamol Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[2-acetyloxy-5-[2-[benzyl(tert-butyl)amino]acetyl]phenyl]methyl acetate (CAS 77430-27-4) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: [2-acetyloxy-5-[2-[benzyl(tert-butyl)amino]acetyl]phenyl]methyl acetate. InChIKey: NCQOUEUIEVCLCE-UHFFFAOYSA-N.

Identity
Molecular formulaC24H29NO5
Molecular weight411.5 g/mol
IUPAC name[2-acetyloxy-5-[2-[benzyl(tert-butyl)amino]acetyl]phenyl]methyl acetate
InChIKeyNCQOUEUIEVCLCE-UHFFFAOYSA-N
SMILESCC(=O)OCC1=C(C=CC(=C1)C(=O)CN(CC2=CC=CC=C2)C(C)(C)C)OC(=O)C

Computed by PubChem (NCBI)