CAS 77541-70-9 is the registry number for 2-Allyl-4,5-dichloropyridazin-3(2H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dichloro-2-prop-2-enylpyridazin-3-one (CAS 77541-70-9) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 4,5-dichloro-2-prop-2-enylpyridazin-3-one. InChIKey: SMFJFRKNBOKQFT-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 4,5-dichloro-2-prop-2-enylpyridazin-3-one |
| InChIKey | SMFJFRKNBOKQFT-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=O)C(=C(C=N1)Cl)Cl |
Computed by PubChem (NCBI)