Products 776328-39-3
CAS 776328-39-3 is the registry number for 8-Oxo-5,6,7,8-Tetrahydronaphthalene-2-carbonitrile, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
8-oxo-6,7-dihydro-5H-naphthalene-2-carbonitrile (CAS 776328-39-3) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 8-oxo-6,7-dihydro-5H-naphthalene-2-carbonitrile. InChIKey: WXWZWMNHMVQTPS-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 8-oxo-6,7-dihydro-5H-naphthalene-2-carbonitrile |
| InChIKey | WXWZWMNHMVQTPS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)C#N)C(=O)C1 |
Computed by PubChem (NCBI)