Products 777061-21-9

CAS 777061-21-9 is the registry number for 5-(p-Tolyl)-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

5-(4-methylphenyl)-1H-indole (CAS 777061-21-9) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 5-(4-methylphenyl)-1H-indole. InChIKey: UPEZZOOZPQQCTL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13N
Molecular weight207.27 g/mol
IUPAC name5-(4-methylphenyl)-1H-indole
InChIKeyUPEZZOOZPQQCTL-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=CC3=C(C=C2)NC=C3

Computed by PubChem (NCBI)